C28H33NO8 — CID 38357907
(2S)-2-[(10R,11S)-10-methyl-10-(4-methylpent-3-enyl)-5-oxo-11-(3-oxobutyl)-9,14-dioxa-4-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1,6,8(15),12-tetraen-4-yl]pentanedioic acid (PubChem CID 38357907) has the molecular formula C28H33NO8 and a molecular weight of 511.57 g/mol. Its IUPAC name is (2S)-2-[(10R,11S)-10-methyl-10-(4-methylpent-3-enyl)-5-oxo-11-(3-oxobutyl)-9,14-dioxa-4-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1,6,8(15),12-tetraen-4-yl]pentanedioic acid.
| Compound Name | (2S)-2-[(10R,11S)-10-methyl-10-(4-methylpent-3-enyl)-5-oxo-11-(3-oxobutyl)-9,14-dioxa-4-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1,6,8(15),12-tetraen-4-yl]pentanedioic acid |
|---|---|
| PubChem CID | 38357907 |
| Molecular Formula | C28H33NO8 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | (2S)-2-[(10R,11S)-10-methyl-10-(4-methylpent-3-enyl)-5-oxo-11-(3-oxobutyl)-9,14-dioxa-4-azatetracyclo[6.6.1.02,6.012,15]pentadeca-1,6,8(15),12-tetraen-4-yl]pentanedioic acid |
| SMILES | CC(=O)CC[C@H]1c2coc3c4c(cc(c23)O[C@]1(C)CCC=C(C)C)C(=O)N([C@@H](CCC(=O)O)C(=O)O)C4 |
| InChI | InChI=1S/C28H33NO8/c1-15(2)6-5-11-28(4)20(8-7-16(3)30)19-14-36-25-18-13-29(21(27(34)35)9-10-23(31)32)26(33)17(18)12-22(37-28)24(19)25/h6,12,14,20-21H,5,7-11,13H2,1-4H3,(H,31,32)(H,34,35)/t20-,21-,28+/m0/s1 |
| InChIKey | BACVPQIMRFXZOM-YHGPEZAFSA-N |
| XLogP | 5.06 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|