C22H18O6 — CID 38360850
(2R)-6-[(2,3-dihydroxyphenyl)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 38360850) has the molecular formula C22H18O6 and a molecular weight of 378.38 g/mol. Its IUPAC name is (2R)-6-[(2,3-dihydroxyphenyl)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-6-[(2,3-dihydroxyphenyl)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 38360850 |
| Molecular Formula | C22H18O6 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (2R)-6-[(2,3-dihydroxyphenyl)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1C[C@H](c2ccccc2)Oc2cc(O)c(Cc3cccc(O)c3O)c(O)c21 |
| InChI | InChI=1S/C22H18O6/c23-15-8-4-7-13(21(15)26)9-14-16(24)10-19-20(22(14)27)17(25)11-18(28-19)12-5-2-1-3-6-12/h1-8,10,18,23-24,26-27H,9,11H2/t18-/m1/s1 |
| InChIKey | FMCBIXROZWHXRU-GOSISDBHSA-N |
| XLogP | 3.81 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|