C29H24O8 — CID 38360858
(2R)-6,8-bis[(2,3-dihydroxyphenyl)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 38360858) has the molecular formula C29H24O8 and a molecular weight of 500.50 g/mol. Its IUPAC name is (2R)-6,8-bis[(2,3-dihydroxyphenyl)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-6,8-bis[(2,3-dihydroxyphenyl)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 38360858 |
| Molecular Formula | C29H24O8 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | (2R)-6,8-bis[(2,3-dihydroxyphenyl)methyl]-5,7-dihydroxy-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | O=C1C[C@H](c2ccccc2)Oc2c(Cc3cccc(O)c3O)c(O)c(Cc3cccc(O)c3O)c(O)c21 |
| InChI | InChI=1S/C29H24O8/c30-20-10-4-8-16(25(20)33)12-18-27(35)19(13-17-9-5-11-21(31)26(17)34)29-24(28(18)36)22(32)14-23(37-29)15-6-2-1-3-7-15/h1-11,23,30-31,33-36H,12-14H2/t23-/m1/s1 |
| InChIKey | WNGIBTXFKBGNIR-HSZRJFAPSA-N |
| XLogP | 4.81 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|