C10H17N3OS — CID 3836548
[(2-methyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b]thiopyran-4-ylidene)amino]urea (PubChem CID 3836548) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is [(2-methyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b]thiopyran-4-ylidene)amino]urea.
| Compound Name | [(2-methyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b]thiopyran-4-ylidene)amino]urea |
|---|---|
| PubChem CID | 3836548 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | [(2-methyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b]thiopyran-4-ylidene)amino]urea |
| SMILES | CC1CC(=NNC(N)=O)C2CCCC2S1 |
| InChI | InChI=1S/C10H17N3OS/c1-6-5-8(12-13-10(11)14)7-3-2-4-9(7)15-6/h6-7,9H,2-5H2,1H3,(H3,11,13,14) |
| InChIKey | XWHDTUUIWQNVNM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|