C21H24N2O4 — CID 38371290
4-[[cyclopropyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]methyl]benzamide (PubChem CID 38371290) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 4-[[cyclopropyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]methyl]benzamide.
| Compound Name | 4-[[cyclopropyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 38371290 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 4-[[cyclopropyl-[2-(3,4-dimethoxyphenyl)acetyl]amino]methyl]benzamide |
| SMILES | COc1ccc(CC(=O)N(Cc2ccc(C(N)=O)cc2)C2CC2)cc1OC |
| InChI | InChI=1S/C21H24N2O4/c1-26-18-10-5-15(11-19(18)27-2)12-20(24)23(17-8-9-17)13-14-3-6-16(7-4-14)21(22)25/h3-7,10-11,17H,8-9,12-13H2,1-2H3,(H2,22,25) |
| InChIKey | POYXCGZJFDFETQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |