About 2,3-dihydro-1,4-benzodioxin-6-ylurea
2,3-dihydro-1,4-benzodioxin-6-ylurea (PubChem CID 3837306) has the molecular formula C9H10N2O3
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-ylurea.
Molecular Properties
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-ylurea |
| PubChem CID | 3837306 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-ylurea |
| SMILES | NC(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C9H10N2O3/c10-9(12)11-6-1-2-7-8(5-6)14-4-3-13-7/h1-2,5H,3-4H2,(H3,10,11,12) |
| InChIKey | KMJYTNSDHAFJCK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1,4-benzodioxin-6-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1,4-benzodioxin-6-ylurea?
The IUPAC name of 2,3-dihydro-1,4-benzodioxin-6-ylurea (CID 3837306) is 2,3-dihydro-1,4-benzodioxin-6-ylurea.
What is the SMILES notation for 2,3-dihydro-1,4-benzodioxin-6-ylurea?
The canonical SMILES for 2,3-dihydro-1,4-benzodioxin-6-ylurea is NC(=O)Nc1ccc2c(c1)OCCO2.
What is the InChIKey of 2,3-dihydro-1,4-benzodioxin-6-ylurea?
The InChIKey is KMJYTNSDHAFJCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c10-9(12)11-6-1-2-7-8(5-6)14-4-3-13-7/h1-2,5H,3-4H2,(H3,10,11,12).
What are the key properties of 2,3-dihydro-1,4-benzodioxin-6-ylurea?
2,3-dihydro-1,4-benzodioxin-6-ylurea has a molecular weight of 194.19 g/mol, XLogP of 0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1,4-benzodioxin-6-ylurea is sourced from PubChem (CID 3837306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).