C22H20N4O2 — CID 3837569
3,6-bis(1H-indol-3-ylmethyl)piperazine-2,5-dione (PubChem CID 3837569) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 3,6-bis(1H-indol-3-ylmethyl)piperazine-2,5-dione.
| Compound Name | 3,6-bis(1H-indol-3-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 3837569 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3,6-bis(1H-indol-3-ylmethyl)piperazine-2,5-dione |
| SMILES | O=C1NC(Cc2c[nH]c3ccccc23)C(=O)NC1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H20N4O2/c27-21-19(9-13-11-23-17-7-3-1-5-15(13)17)25-22(28)20(26-21)10-14-12-24-18-8-4-2-6-16(14)18/h1-8,11-12,19-20,23-24H,9-10H2,(H,25,28)(H,26,27) |
| InChIKey | DNHODRZUCGXYKU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |