C16H12N4O2 — CID 3837660
6-imino-1-methyl-8-phenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3837660) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 6-imino-1-methyl-8-phenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 6-imino-1-methyl-8-phenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3837660 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 6-imino-1-methyl-8-phenyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(C)OCC(C#N)(C#N)C1(C#N)C2c1ccccc1 |
| InChI | InChI=1S/C16H12N4O2/c1-14-12(11-5-3-2-4-6-11)16(9-19,13(20)22-14)15(7-17,8-18)10-21-14/h2-6,12,20H,10H2,1H3/b20-13- |
| InChIKey | BAXNSEMIVSSOBB-MOSHPQCFSA-N |
| XLogP | 2.07 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|