About 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine
3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine (PubChem CID 3838266) has the molecular formula C10H8N8
and a molecular weight of 240.23 g/mol. Its IUPAC name is 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine |
| PubChem CID | 3838266 |
| Molecular Formula | C10H8N8 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(-c2cnccn2)nnc1-c1cnccn1 |
| InChI | InChI=1S/C10H8N8/c11-18-9(7-5-12-1-3-14-7)16-17-10(18)8-6-13-2-4-15-8/h1-6H,11H2 |
| InChIKey | GRLYZUZCKLCCCB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine?
The IUPAC name of 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine (CID 3838266) is 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine.
What is the SMILES notation for 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine?
The canonical SMILES for 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine is Nn1c(-c2cnccn2)nnc1-c1cnccn1.
What is the InChIKey of 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine?
The InChIKey is GRLYZUZCKLCCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N8/c11-18-9(7-5-12-1-3-14-7)16-17-10(18)8-6-13-2-4-15-8/h1-6H,11H2.
What are the key properties of 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine?
3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine has a molecular weight of 240.23 g/mol, XLogP of -0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-di(pyrazin-2-yl)-1,2,4-triazol-4-amine is sourced from PubChem (CID 3838266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).