C10H11ClN2O3 — CID 3838662
2-[(2-chlorophenyl)carbamoylamino]propanoic acid (PubChem CID 3838662) has the molecular formula C10H11ClN2O3 and a molecular weight of 242.66 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)carbamoylamino]propanoic acid.
| Compound Name | 2-[(2-chlorophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 3838662 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.66 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-[(2-chlorophenyl)carbamoylamino]propanoic acid |
| SMILES | CC(NC(=O)Nc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C10H11ClN2O3/c1-6(9(14)15)12-10(16)13-8-5-3-2-4-7(8)11/h2-6H,1H3,(H,14,15)(H2,12,13,16) |
| InChIKey | WQFVYGFYMSRCFT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.66 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |