C21H25N3O2 — CID 38387385
1-[(3-methylphenyl)methyl]-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]urea (PubChem CID 38387385) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]urea.
| Compound Name | 1-[(3-methylphenyl)methyl]-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 38387385 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-3-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]urea |
| SMILES | Cc1cccc(CNC(=O)NCc2cccc(CN3CCCC3=O)c2)c1 |
| InChI | InChI=1S/C21H25N3O2/c1-16-5-2-6-17(11-16)13-22-21(26)23-14-18-7-3-8-19(12-18)15-24-10-4-9-20(24)25/h2-3,5-8,11-12H,4,9-10,13-15H2,1H3,(H2,22,23,26) |
| InChIKey | PQAUGLTXJCUKIR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |