About 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol
2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol (PubChem CID 3839082) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol.
Molecular Properties
| Compound Name | 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol |
| PubChem CID | 3839082 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol |
| SMILES | CC1C(c2ccccc2)OC(c2ccccc2O)N1C |
| InChI | InChI=1S/C17H19NO2/c1-12-16(13-8-4-3-5-9-13)20-17(18(12)2)14-10-6-7-11-15(14)19/h3-12,16-17,19H,1-2H3 |
| InChIKey | BOKYNTRREGYZJE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol?
The IUPAC name of 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol (CID 3839082) is 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol.
What is the SMILES notation for 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol?
The canonical SMILES for 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol is CC1C(c2ccccc2)OC(c2ccccc2O)N1C.
What is the InChIKey of 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol?
The InChIKey is BOKYNTRREGYZJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2/c1-12-16(13-8-4-3-5-9-13)20-17(18(12)2)14-10-6-7-11-15(14)19/h3-12,16-17,19H,1-2H3.
What are the key properties of 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol?
2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol has a molecular weight of 269.34 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl)phenol is sourced from PubChem (CID 3839082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).