About N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide
N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide (PubChem CID 3839091) has the molecular formula C21H27N3O
and a molecular weight of 337.47 g/mol. Its IUPAC name is N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide.
Molecular Properties
| Compound Name | N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide |
| PubChem CID | 3839091 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide |
| SMILES | CC(C)N(/C(=N\Cc1ccccc1)NC(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C21H27N3O/c1-16(2)24(17(3)4)21(22-15-18-11-7-5-8-12-18)23-20(25)19-13-9-6-10-14-19/h5-14,16-17H,15H2,1-4H3,(H,22,23,25) |
| InChIKey | WNYZHPKSSNUNSE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide?
The IUPAC name of N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide (CID 3839091) is N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide.
What is the SMILES notation for N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide?
The canonical SMILES for N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide is CC(C)N(/C(=N\Cc1ccccc1)NC(=O)c1ccccc1)C(C)C.
What is the InChIKey of N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide?
The InChIKey is WNYZHPKSSNUNSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O/c1-16(2)24(17(3)4)21(22-15-18-11-7-5-8-12-18)23-20(25)19-13-9-6-10-14-19/h5-14,16-17H,15H2,1-4H3,(H,22,23,25).
What are the key properties of N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide?
N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide has a molecular weight of 337.47 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[N'-benzyl-N,N-di(propan-2-yl)carbamimidoyl]benzamide is sourced from PubChem (CID 3839091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).