C17H30O2 — CID 3839279
7,9,11-trimethyl-3-pentyl-2,4-dioxaspiro[5.5]undec-9-ene (PubChem CID 3839279) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 7,9,11-trimethyl-3-pentyl-2,4-dioxaspiro[5.5]undec-9-ene.
| Compound Name | 7,9,11-trimethyl-3-pentyl-2,4-dioxaspiro[5.5]undec-9-ene |
|---|---|
| PubChem CID | 3839279 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 7,9,11-trimethyl-3-pentyl-2,4-dioxaspiro[5.5]undec-9-ene |
| SMILES | CCCCCC1OCC2(CO1)C(C)C=C(C)CC2C |
| InChI | InChI=1S/C17H30O2/c1-5-6-7-8-16-18-11-17(12-19-16)14(3)9-13(2)10-15(17)4/h9,14-16H,5-8,10-12H2,1-4H3 |
| InChIKey | FUISBEMCOIUUEM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|