About ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate
ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate (PubChem CID 3839820) has the molecular formula C17H24N2O2S
and a molecular weight of 320.46 g/mol. Its IUPAC name is ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate |
| PubChem CID | 3839820 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=S)Nc2ccc(C)cc2C)C1 |
| InChI | InChI=1S/C17H24N2O2S/c1-4-21-16(20)14-6-5-9-19(11-14)17(22)18-15-8-7-12(2)10-13(15)3/h7-8,10,14H,4-6,9,11H2,1-3H3,(H,18,22) |
| InChIKey | TZBYMJWEZMEWGU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate?
The IUPAC name of ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate (CID 3839820) is ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate.
What is the SMILES notation for ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate?
The canonical SMILES for ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate is CCOC(=O)C1CCCN(C(=S)Nc2ccc(C)cc2C)C1.
What is the InChIKey of ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate?
The InChIKey is TZBYMJWEZMEWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2S/c1-4-21-16(20)14-6-5-9-19(11-14)17(22)18-15-8-7-12(2)10-13(15)3/h7-8,10,14H,4-6,9,11H2,1-3H3,(H,18,22).
What are the key properties of ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate?
ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate has a molecular weight of 320.46 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(2,4-dimethylphenyl)carbamothioyl]piperidine-3-carboxylate is sourced from PubChem (CID 3839820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).