About 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate
2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate (PubChem CID 3839879) has the molecular formula C11H16N2O2S3
and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate |
| PubChem CID | 3839879 |
| Molecular Formula | C11H16N2O2S3 |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate |
| SMILES | O=C1CCC(=O)N1CCSC(=S)N1CCSCC1 |
| InChI | InChI=1S/C11H16N2O2S3/c14-9-1-2-10(15)13(9)5-8-18-11(16)12-3-6-17-7-4-12/h1-8H2 |
| InChIKey | YTOMHXQCBCNQOF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate?
The IUPAC name of 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate (CID 3839879) is 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate.
What is the SMILES notation for 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate?
The canonical SMILES for 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate is O=C1CCC(=O)N1CCSC(=S)N1CCSCC1.
What is the InChIKey of 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate?
The InChIKey is YTOMHXQCBCNQOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S3/c14-9-1-2-10(15)13(9)5-8-18-11(16)12-3-6-17-7-4-12/h1-8H2.
What are the key properties of 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate?
2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate has a molecular weight of 304.46 g/mol, XLogP of 1.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrolidin-1-yl)ethyl thiomorpholine-4-carbodithioate is sourced from PubChem (CID 3839879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).