C17H18N2O4 — CID 38401851
2-hydroxy-4-methoxy-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]benzamide (PubChem CID 38401851) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]benzamide.
| Compound Name | 2-hydroxy-4-methoxy-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 38401851 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-hydroxy-4-methoxy-N-[4-[2-(methylamino)-2-oxoethyl]phenyl]benzamide |
| SMILES | CNC(=O)Cc1ccc(NC(=O)c2ccc(OC)cc2O)cc1 |
| InChI | InChI=1S/C17H18N2O4/c1-18-16(21)9-11-3-5-12(6-4-11)19-17(22)14-8-7-13(23-2)10-15(14)20/h3-8,10,20H,9H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | DWPCLWODMHOGFI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |