About 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone
2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone (PubChem CID 3840352) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone.
Molecular Properties
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone |
| PubChem CID | 3840352 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone |
| SMILES | Nc1ncn(CC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C10H10N4O/c11-10-12-7-14(13-10)6-9(15)8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,11,13) |
| InChIKey | MBEDUFGINAMFOY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone?
The IUPAC name of 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone (CID 3840352) is 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone.
What is the SMILES notation for 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone?
The canonical SMILES for 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone is Nc1ncn(CC(=O)c2ccccc2)n1.
What is the InChIKey of 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone?
The InChIKey is MBEDUFGINAMFOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O/c11-10-12-7-14(13-10)6-9(15)8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,11,13).
What are the key properties of 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone?
2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone has a molecular weight of 202.22 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1,2,4-triazol-1-yl)-1-phenylethanone is sourced from PubChem (CID 3840352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).