About 1-(1,3-dioctoxyhex-5-enyl)benzotriazole
1-(1,3-dioctoxyhex-5-enyl)benzotriazole (PubChem CID 3841171) has the molecular formula C28H47N3O2
and a molecular weight of 457.70 g/mol. Its IUPAC name is 1-(1,3-dioctoxyhex-5-enyl)benzotriazole.
Molecular Properties
| Compound Name | 1-(1,3-dioctoxyhex-5-enyl)benzotriazole |
| PubChem CID | 3841171 |
| Molecular Formula | C28H47N3O2 |
| Molecular Weight | 457.70 g/mol |
| Exact Mass | 457.37 |
| IUPAC Name | 1-(1,3-dioctoxyhex-5-enyl)benzotriazole |
| SMILES | C=CCC(CC(OCCCCCCCC)n1nnc2ccccc21)OCCCCCCCC |
| InChI | InChI=1S/C28H47N3O2/c1-4-7-9-11-13-17-22-32-25(19-6-3)24-28(33-23-18-14-12-10-8-5-2)31-27-21-16-15-20-26(27)29-30-31/h6,15-16,20-21,25,28H,3-5,7-14,17-19,22-24H2,1-2H3 |
| InChIKey | IEUPOKKAXVNTOA-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.70 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-dioctoxyhex-5-enyl)benzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dioctoxyhex-5-enyl)benzotriazole?
The IUPAC name of 1-(1,3-dioctoxyhex-5-enyl)benzotriazole (CID 3841171) is 1-(1,3-dioctoxyhex-5-enyl)benzotriazole.
What is the SMILES notation for 1-(1,3-dioctoxyhex-5-enyl)benzotriazole?
The canonical SMILES for 1-(1,3-dioctoxyhex-5-enyl)benzotriazole is C=CCC(CC(OCCCCCCCC)n1nnc2ccccc21)OCCCCCCCC.
What is the InChIKey of 1-(1,3-dioctoxyhex-5-enyl)benzotriazole?
The InChIKey is IEUPOKKAXVNTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H47N3O2/c1-4-7-9-11-13-17-22-32-25(19-6-3)24-28(33-23-18-14-12-10-8-5-2)31-27-21-16-15-20-26(27)29-30-31/h6,15-16,20-21,25,28H,3-5,7-14,17-19,22-24H2,1-2H3.
What are the key properties of 1-(1,3-dioctoxyhex-5-enyl)benzotriazole?
1-(1,3-dioctoxyhex-5-enyl)benzotriazole has a molecular weight of 457.70 g/mol, XLogP of 8.02, 21 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dioctoxyhex-5-enyl)benzotriazole is sourced from PubChem (CID 3841171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).