C16H16Cl2N2S — CID 3841531
3-(3,5-dichlorophenyl)-1-ethyl-1-(3-methylphenyl)thiourea (PubChem CID 3841531) has the molecular formula C16H16Cl2N2S and a molecular weight of 339.29 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-1-ethyl-1-(3-methylphenyl)thiourea.
| Compound Name | 3-(3,5-dichlorophenyl)-1-ethyl-1-(3-methylphenyl)thiourea |
|---|---|
| PubChem CID | 3841531 |
| Molecular Formula | C16H16Cl2N2S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-1-ethyl-1-(3-methylphenyl)thiourea |
| SMILES | CCN(C(=S)Nc1cc(Cl)cc(Cl)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C16H16Cl2N2S/c1-3-20(15-6-4-5-11(2)7-15)16(21)19-14-9-12(17)8-13(18)10-14/h4-10H,3H2,1-2H3,(H,19,21) |
| InChIKey | AXRUJABPBMQHGF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|