About ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate
ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 3841622) has the molecular formula C15H16F2N2O4
and a molecular weight of 326.30 g/mol. Its IUPAC name is ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate |
| PubChem CID | 3841622 |
| Molecular Formula | C15H16F2N2O4 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1C(=O)NCCN1C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H16F2N2O4/c1-2-23-13(20)8-12-14(21)18-5-6-19(12)15(22)10-4-3-9(16)7-11(10)17/h3-4,7,12H,2,5-6,8H2,1H3,(H,18,21) |
| InChIKey | BNZRSIGHDXIZTF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate?
The IUPAC name of ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate (CID 3841622) is ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate.
What is the SMILES notation for ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate?
The canonical SMILES for ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate is CCOC(=O)CC1C(=O)NCCN1C(=O)c1ccc(F)cc1F.
What is the InChIKey of ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate?
The InChIKey is BNZRSIGHDXIZTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N2O4/c1-2-23-13(20)8-12-14(21)18-5-6-19(12)15(22)10-4-3-9(16)7-11(10)17/h3-4,7,12H,2,5-6,8H2,1H3,(H,18,21).
What are the key properties of ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate?
ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate has a molecular weight of 326.30 g/mol, XLogP of 0.86, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-(2,4-difluorobenzoyl)-3-oxopiperazin-2-yl]acetate is sourced from PubChem (CID 3841622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).