C28H42N4O4 — CID 3841636
1-(2-methoxyethyl)-3-[6-[[2-methoxyethyl-(2-methylphenyl)carbamoyl]amino]hexyl]-1-(2-methylphenyl)urea (PubChem CID 3841636) has the molecular formula C28H42N4O4 and a molecular weight of 498.67 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[6-[[2-methoxyethyl-(2-methylphenyl)carbamoyl]amino]hexyl]-1-(2-methylphenyl)urea.
| Compound Name | 1-(2-methoxyethyl)-3-[6-[[2-methoxyethyl-(2-methylphenyl)carbamoyl]amino]hexyl]-1-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3841636 |
| Molecular Formula | C28H42N4O4 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[6-[[2-methoxyethyl-(2-methylphenyl)carbamoyl]amino]hexyl]-1-(2-methylphenyl)urea |
| SMILES | COCCN(C(=O)NCCCCCCNC(=O)N(CCOC)c1ccccc1C)c1ccccc1C |
| InChI | InChI=1S/C28H42N4O4/c1-23-13-7-9-15-25(23)31(19-21-35-3)27(33)29-17-11-5-6-12-18-30-28(34)32(20-22-36-4)26-16-10-8-14-24(26)2/h7-10,13-16H,5-6,11-12,17-22H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | QURSWZUEGCWLAG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|