C10H12N4 — CID 3841720
6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-amine (PubChem CID 3841720) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-amine.
| Compound Name | 6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-amine |
|---|---|
| PubChem CID | 3841720 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-amine |
| SMILES | Nc1ncnc2[nH]c3c(c12)CCCC3 |
| InChI | InChI=1S/C10H12N4/c11-9-8-6-3-1-2-4-7(6)14-10(8)13-5-12-9/h5H,1-4H2,(H3,11,12,13,14) |
| InChIKey | GKKITIFSWKFEKP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |