C19H23ClN4O — CID 38418024
[4-[(1R)-1-(2-chlorophenyl)ethyl]piperazin-1-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone (PubChem CID 38418024) has the molecular formula C19H23ClN4O and a molecular weight of 358.87 g/mol. Its IUPAC name is [4-[(1R)-1-(2-chlorophenyl)ethyl]piperazin-1-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone.
| Compound Name | [4-[(1R)-1-(2-chlorophenyl)ethyl]piperazin-1-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 38418024 |
| Molecular Formula | C19H23ClN4O |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [4-[(1R)-1-(2-chlorophenyl)ethyl]piperazin-1-yl]-(5-cyclopropyl-1H-pyrazol-3-yl)methanone |
| SMILES | C[C@H](c1ccccc1Cl)N1CCN(C(=O)c2cc(C3CC3)[nH]n2)CC1 |
| InChI | InChI=1S/C19H23ClN4O/c1-13(15-4-2-3-5-16(15)20)23-8-10-24(11-9-23)19(25)18-12-17(21-22-18)14-6-7-14/h2-5,12-14H,6-11H2,1H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | JWMBDJGBUINXEQ-CYBMUJFWSA-N |
| XLogP | 3.46 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |