C15H22N4OS2 — CID 3842041
(12-ethyl-12-methyl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazine (PubChem CID 3842041) has the molecular formula C15H22N4OS2 and a molecular weight of 338.50 g/mol. Its IUPAC name is (12-ethyl-12-methyl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazine.
| Compound Name | (12-ethyl-12-methyl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazine |
|---|---|
| PubChem CID | 3842041 |
| Molecular Formula | C15H22N4OS2 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (12-ethyl-12-methyl-5-propylsulfanyl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)hydrazine |
| SMILES | CCCSc1nc(NN)c2c3c(sc2n1)COC(C)(CC)C3 |
| InChI | InChI=1S/C15H22N4OS2/c1-4-6-21-14-17-12(19-16)11-9-7-15(3,5-2)20-8-10(9)22-13(11)18-14/h4-8,16H2,1-3H3,(H,17,18,19) |
| InChIKey | FZOOKCPQJGEORF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|