C16H16N4O — CID 3842142
9-ethyl-9-methyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one (PubChem CID 3842142) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 9-ethyl-9-methyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one.
| Compound Name | 9-ethyl-9-methyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one |
|---|---|
| PubChem CID | 3842142 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 9-ethyl-9-methyl-12,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,16-hexaen-11-one |
| SMILES | CCC1(C)Cc2ccccc2-c2nc3[nH]ncn3c(=O)c21 |
| InChI | InChI=1S/C16H16N4O/c1-3-16(2)8-10-6-4-5-7-11(10)13-12(16)14(21)20-9-17-19-15(20)18-13/h4-7,9H,3,8H2,1-2H3,(H,18,19) |
| InChIKey | WNWCIQOFQWBKNH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |