About 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one
2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 3842968) has the molecular formula C11H10BrNO3S
and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 3842968 |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CC=CCBr |
| InChI | InChI=1S/C11H10BrNO3S/c12-7-3-4-8-13-11(14)9-5-1-2-6-10(9)17(13,15)16/h1-6H,7-8H2 |
| InChIKey | UYUWGEJGMRWBQV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one (CID 3842968) is 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one is O=C1c2ccccc2S(=O)(=O)N1CC=CCBr.
What is the InChIKey of 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is UYUWGEJGMRWBQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO3S/c12-7-3-4-8-13-11(14)9-5-1-2-6-10(9)17(13,15)16/h1-6H,7-8H2.
What are the key properties of 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one?
2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 316.18 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 3842968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).