C11H10BrNO3S — CID 3842968
2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 3842968) has the molecular formula C11H10BrNO3S and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 3842968 |
| Molecular Formula | C11H10BrNO3S |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 314.96 |
| IUPAC Name | 2-(4-bromobut-2-enyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CC=CCBr |
| InChI | InChI=1S/C11H10BrNO3S/c12-7-3-4-8-13-11(14)9-5-1-2-6-10(9)17(13,15)16/h1-6H,7-8H2 |
| InChIKey | UYUWGEJGMRWBQV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|