C18H19N3O — CID 38432063
4,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-1H-indole-2-carboxamide (PubChem CID 38432063) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 4,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-1H-indole-2-carboxamide.
| Compound Name | 4,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 38432063 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 4,6-dimethyl-N-[(1R)-1-pyridin-2-ylethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1cc(C)c2cc(C(=O)N[C@H](C)c3ccccn3)[nH]c2c1 |
| InChI | InChI=1S/C18H19N3O/c1-11-8-12(2)14-10-17(21-16(14)9-11)18(22)20-13(3)15-6-4-5-7-19-15/h4-10,13,21H,1-3H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | PZHHSFFISKUIET-CYBMUJFWSA-N |
| XLogP | 3.67 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |