C25H29N5O2 — CID 38435626
2-N,6-N-bis[2-[(dimethylamino)methyl]phenyl]pyridine-2,6-dicarboxamide (PubChem CID 38435626) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-N,6-N-bis[2-[(dimethylamino)methyl]phenyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[2-[(dimethylamino)methyl]phenyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 38435626 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 2-N,6-N-bis[2-[(dimethylamino)methyl]phenyl]pyridine-2,6-dicarboxamide |
| SMILES | CN(C)Cc1ccccc1NC(=O)c1cccc(C(=O)Nc2ccccc2CN(C)C)n1 |
| InChI | InChI=1S/C25H29N5O2/c1-29(2)16-18-10-5-7-12-20(18)27-24(31)22-14-9-15-23(26-22)25(32)28-21-13-8-6-11-19(21)17-30(3)4/h5-15H,16-17H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | AVNKGYFYYZJJBM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |