C21H20N4O2 — CID 3844330
13-imino-10-(4-methylphenyl)-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile (PubChem CID 3844330) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is 13-imino-10-(4-methylphenyl)-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile.
| Compound Name | 13-imino-10-(4-methylphenyl)-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
|---|---|
| PubChem CID | 3844330 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 13-imino-10-(4-methylphenyl)-11,12-dioxatricyclo[6.3.2.01,7]tridecane-8,9,9-tricarbonitrile |
| SMILES | [H]/N=C1/OC23CCCCCC2C1(C#N)C(C#N)(C#N)C(c1ccc(C)cc1)O3 |
| InChI | InChI=1S/C21H20N4O2/c1-14-6-8-15(9-7-14)17-19(11-22,12-23)20(13-24)16-5-3-2-4-10-21(16,26-17)27-18(20)25/h6-9,16-17,25H,2-5,10H2,1H3/b25-18+ |
| InChIKey | PKDKTLASUVQSFI-XIEYBQDHSA-N |
| XLogP | 3.89 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|