C20H19BrN2O2S — CID 3844465
2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 3844465) has the molecular formula C20H19BrN2O2S and a molecular weight of 431.36 g/mol. Its IUPAC name is 2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 3844465 |
| Molecular Formula | C20H19BrN2O2S |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 2-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | C=CCOc1c(Br)cc(C=Nc2sc3c(c2C#N)CCCC3)cc1OC |
| InChI | InChI=1S/C20H19BrN2O2S/c1-3-8-25-19-16(21)9-13(10-17(19)24-2)12-23-20-15(11-22)14-6-4-5-7-18(14)26-20/h3,9-10,12H,1,4-8H2,2H3 |
| InChIKey | WJTZZHGBNMLVGF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 54.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|