About 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine
2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine (PubChem CID 3845246) has the molecular formula C19H18N2
and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine.
Molecular Properties
| Compound Name | 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine |
| PubChem CID | 3845246 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine |
| SMILES | c1ccc(CN2CCc3nc4ccccc4cc3C2)cc1 |
| InChI | InChI=1S/C19H18N2/c1-2-6-15(7-3-1)13-21-11-10-19-17(14-21)12-16-8-4-5-9-18(16)20-19/h1-9,12H,10-11,13-14H2 |
| InChIKey | BIGIFNAKNRWTPE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine?
The IUPAC name of 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine (CID 3845246) is 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine.
What is the SMILES notation for 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine?
The canonical SMILES for 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine is c1ccc(CN2CCc3nc4ccccc4cc3C2)cc1.
What is the InChIKey of 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine?
The InChIKey is BIGIFNAKNRWTPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2/c1-2-6-15(7-3-1)13-21-11-10-19-17(14-21)12-16-8-4-5-9-18(16)20-19/h1-9,12H,10-11,13-14H2.
What are the key properties of 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine?
2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine has a molecular weight of 274.37 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-3,4-dihydro-1H-benzo[b][1,6]naphthyridine is sourced from PubChem (CID 3845246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).