C35H37N3O3 — CID 3845391
N-[(13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]-9-oxo-10H-acridine-4-carboxamide (PubChem CID 3845391) has the molecular formula C35H37N3O3 and a molecular weight of 547.70 g/mol. Its IUPAC name is N-[(13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]-9-oxo-10H-acridine-4-carboxamide.
| Compound Name | N-[(13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]-9-oxo-10H-acridine-4-carboxamide |
|---|---|
| PubChem CID | 3845391 |
| Molecular Formula | C35H37N3O3 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | N-[(13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ylidene)amino]-9-oxo-10H-acridine-4-carboxamide |
| SMILES | C#CC1(O)CCC2C3CCC4=CC(=NNC(=O)c5cccc6c(=O)c7ccccc7[nH]c56)CCC4C3CCC21CC |
| InChI | InChI=1S/C35H37N3O3/c1-3-34-18-16-24-23-15-13-22(20-21(23)12-14-25(24)29(34)17-19-35(34,41)4-2)37-38-33(40)28-10-7-9-27-31(28)36-30-11-6-5-8-26(30)32(27)39/h2,5-11,20,23-25,29,41H,3,12-19H2,1H3,(H,36,39)(H,38,40) |
| InChIKey | MMPFAQBCJMMYGH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|