C22H17ClN6O2 — CID 3845753
ethyl N-[13-[(2-chlorophenyl)methyl]-12-oxo-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-17-yl]methanimidate (PubChem CID 3845753) has the molecular formula C22H17ClN6O2 and a molecular weight of 432.87 g/mol. Its IUPAC name is ethyl N-[13-[(2-chlorophenyl)methyl]-12-oxo-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-17-yl]methanimidate.
| Compound Name | ethyl N-[13-[(2-chlorophenyl)methyl]-12-oxo-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-17-yl]methanimidate |
|---|---|
| PubChem CID | 3845753 |
| Molecular Formula | C22H17ClN6O2 |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | ethyl N-[13-[(2-chlorophenyl)methyl]-12-oxo-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-17-yl]methanimidate |
| SMILES | CCOC=Nn1c2nc3ccccc3nc2c2c(=O)n(Cc3ccccc3Cl)cnc21 |
| InChI | InChI=1S/C22H17ClN6O2/c1-2-31-13-25-29-20-18(19-21(29)27-17-10-6-5-9-16(17)26-19)22(30)28(12-24-20)11-14-7-3-4-8-15(14)23/h3-10,12-13H,2,11H2,1H3 |
| InChIKey | GETYBTIFBHWCCH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|