C18H16Cl3N3O — CID 3845942
2,4,6-trichloro-N-[(5-methoxy-1,2-dimethylindol-3-yl)methylideneamino]aniline (PubChem CID 3845942) has the molecular formula C18H16Cl3N3O and a molecular weight of 396.71 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(5-methoxy-1,2-dimethylindol-3-yl)methylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[(5-methoxy-1,2-dimethylindol-3-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 3845942 |
| Molecular Formula | C18H16Cl3N3O |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2,4,6-trichloro-N-[(5-methoxy-1,2-dimethylindol-3-yl)methylideneamino]aniline |
| SMILES | COc1ccc2c(c1)c(C=NNc1c(Cl)cc(Cl)cc1Cl)c(C)n2C |
| InChI | InChI=1S/C18H16Cl3N3O/c1-10-14(13-8-12(25-3)4-5-17(13)24(10)2)9-22-23-18-15(20)6-11(19)7-16(18)21/h4-9,23H,1-3H3 |
| InChIKey | FWCJWAQJTKRFTC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|