C12H10N4S — CID 3845996
4-prop-2-enylsulfanyl-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 3845996) has the molecular formula C12H10N4S and a molecular weight of 242.31 g/mol. Its IUPAC name is 4-prop-2-enylsulfanyl-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 4-prop-2-enylsulfanyl-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 3845996 |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 4-prop-2-enylsulfanyl-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | C=CCSc1nc2ccccc2n2cnnc12 |
| InChI | InChI=1S/C12H10N4S/c1-2-7-17-12-11-15-13-8-16(11)10-6-4-3-5-9(10)14-12/h2-6,8H,1,7H2 |
| InChIKey | NEFIACXFKDDCJP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|