C16H18BrN3O2 — CID 3846083
N-[(3-bromophenyl)methyl]-2-piperidin-3-yl-1,3-oxazole-4-carboxamide (PubChem CID 3846083) has the molecular formula C16H18BrN3O2 and a molecular weight of 364.24 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2-piperidin-3-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(3-bromophenyl)methyl]-2-piperidin-3-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3846083 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2-piperidin-3-yl-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1coc(C2CCCNC2)n1 |
| InChI | InChI=1S/C16H18BrN3O2/c17-13-5-1-3-11(7-13)8-19-15(21)14-10-22-16(20-14)12-4-2-6-18-9-12/h1,3,5,7,10,12,18H,2,4,6,8-9H2,(H,19,21) |
| InChIKey | LEXXUQVUXDRRAM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |