About 3-methyl-1,4-dihydroquinazolin-2-one
3-methyl-1,4-dihydroquinazolin-2-one (PubChem CID 3846558) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-methyl-1,4-dihydroquinazolin-2-one.
Molecular Properties
| Compound Name | 3-methyl-1,4-dihydroquinazolin-2-one |
| PubChem CID | 3846558 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-methyl-1,4-dihydroquinazolin-2-one |
| SMILES | CN1Cc2ccccc2NC1=O |
| InChI | InChI=1S/C9H10N2O/c1-11-6-7-4-2-3-5-8(7)10-9(11)12/h2-5H,6H2,1H3,(H,10,12) |
| InChIKey | GINUUQLRYXHAPB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-1,4-dihydroquinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,4-dihydroquinazolin-2-one?
The IUPAC name of 3-methyl-1,4-dihydroquinazolin-2-one (CID 3846558) is 3-methyl-1,4-dihydroquinazolin-2-one.
What is the SMILES notation for 3-methyl-1,4-dihydroquinazolin-2-one?
The canonical SMILES for 3-methyl-1,4-dihydroquinazolin-2-one is CN1Cc2ccccc2NC1=O.
What is the InChIKey of 3-methyl-1,4-dihydroquinazolin-2-one?
The InChIKey is GINUUQLRYXHAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c1-11-6-7-4-2-3-5-8(7)10-9(11)12/h2-5H,6H2,1H3,(H,10,12).
What are the key properties of 3-methyl-1,4-dihydroquinazolin-2-one?
3-methyl-1,4-dihydroquinazolin-2-one has a molecular weight of 162.19 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,4-dihydroquinazolin-2-one is sourced from PubChem (CID 3846558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).