About N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide
N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (PubChem CID 38467487) has the molecular formula C15H9N3O3S2
and a molecular weight of 343.39 g/mol. Its IUPAC name is N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| PubChem CID | 38467487 |
| Molecular Formula | C15H9N3O3S2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2oc(=O)[nH]c2c1)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C15H9N3O3S2/c19-13(10-7-23-14(17-10)12-2-1-5-22-12)16-8-3-4-11-9(6-8)18-15(20)21-11/h1-7H,(H,16,19)(H,18,20) |
| InChIKey | CWIVKJQLFQBPDY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide?
The IUPAC name of N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide (CID 38467487) is N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide is O=C(Nc1ccc2oc(=O)[nH]c2c1)c1csc(-c2cccs2)n1.
What is the InChIKey of N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide?
The InChIKey is CWIVKJQLFQBPDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N3O3S2/c19-13(10-7-23-14(17-10)12-2-1-5-22-12)16-8-3-4-11-9(6-8)18-15(20)21-11/h1-7H,(H,16,19)(H,18,20).
What are the key properties of N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide?
N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide has a molecular weight of 343.39 g/mol, XLogP of 3.56, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-3H-1,3-benzoxazol-5-yl)-2-thiophen-2-yl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 38467487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).