C15H26N6O2 — CID 3846962
4-N-cyclohexyl-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4,6-triamine (PubChem CID 3846962) has the molecular formula C15H26N6O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-N-cyclohexyl-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4,6-triamine.
| Compound Name | 4-N-cyclohexyl-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 3846962 |
| Molecular Formula | C15H26N6O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 4-N-cyclohexyl-2-N-(3-methylbutyl)-5-nitropyrimidine-2,4,6-triamine |
| SMILES | CC(C)CCNc1nc(N)c([N+](=O)[O-])c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C15H26N6O2/c1-10(2)8-9-17-15-19-13(16)12(21(22)23)14(20-15)18-11-6-4-3-5-7-11/h10-11H,3-9H2,1-2H3,(H4,16,17,18,19,20) |
| InChIKey | LKOYRMZRFRTGFR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|