C20H21FN2O3 — CID 38472427
[4-(4-fluorobenzoyl)-1,4-diazepan-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 38472427) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is [4-(4-fluorobenzoyl)-1,4-diazepan-1-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-(4-fluorobenzoyl)-1,4-diazepan-1-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 38472427 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | [4-(4-fluorobenzoyl)-1,4-diazepan-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCN(C(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21FN2O3/c1-26-18-9-5-16(6-10-18)20(25)23-12-2-11-22(13-14-23)19(24)15-3-7-17(21)8-4-15/h3-10H,2,11-14H2,1H3 |
| InChIKey | YRDSEYUYKDRQJQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |