C21H28N2O4 — CID 38474824
1-(cyclopropanecarbonyl)-N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]piperidine-4-carboxamide (PubChem CID 38474824) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(cyclopropanecarbonyl)-N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38474824 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-N-[3-[[(2S)-oxolan-2-yl]methoxy]phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(OC[C@@H]2CCCO2)c1)C1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C21H28N2O4/c24-20(15-8-10-23(11-9-15)21(25)16-6-7-16)22-17-3-1-4-18(13-17)27-14-19-5-2-12-26-19/h1,3-4,13,15-16,19H,2,5-12,14H2,(H,22,24)/t19-/m0/s1 |
| InChIKey | HSAJCJQFPFOEKY-IBGZPJMESA-N |
| XLogP | 2.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |