About 1,1-dicyclohexylthiourea
1,1-dicyclohexylthiourea (PubChem CID 3847649) has the molecular formula C13H24N2S
and a molecular weight of 240.42 g/mol. Its IUPAC name is 1,1-dicyclohexylthiourea.
Molecular Properties
| Compound Name | 1,1-dicyclohexylthiourea |
| PubChem CID | 3847649 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1,1-dicyclohexylthiourea |
| SMILES | NC(=S)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H24N2S/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,16) |
| InChIKey | AZERQDZCGIDXHT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dicyclohexylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dicyclohexylthiourea?
The IUPAC name of 1,1-dicyclohexylthiourea (CID 3847649) is 1,1-dicyclohexylthiourea.
What is the SMILES notation for 1,1-dicyclohexylthiourea?
The canonical SMILES for 1,1-dicyclohexylthiourea is NC(=S)N(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 1,1-dicyclohexylthiourea?
The InChIKey is AZERQDZCGIDXHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2S/c14-13(16)15(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,16).
What are the key properties of 1,1-dicyclohexylthiourea?
1,1-dicyclohexylthiourea has a molecular weight of 240.42 g/mol, XLogP of 3.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dicyclohexylthiourea is sourced from PubChem (CID 3847649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).