About 2-methyl-1H-imidazole-4,5-dicarbonitrile
2-methyl-1H-imidazole-4,5-dicarbonitrile (PubChem CID 3847698) has the molecular formula C6H4N4
and a molecular weight of 132.13 g/mol. Its IUPAC name is 2-methyl-1H-imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-methyl-1H-imidazole-4,5-dicarbonitrile |
| PubChem CID | 3847698 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 2-methyl-1H-imidazole-4,5-dicarbonitrile |
| SMILES | Cc1nc(C#N)c(C#N)[nH]1 |
| InChI | InChI=1S/C6H4N4/c1-4-9-5(2-7)6(3-8)10-4/h1H3,(H,9,10) |
| InChIKey | ZEAVNOQDMHVDLU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1H-imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-imidazole-4,5-dicarbonitrile?
The IUPAC name of 2-methyl-1H-imidazole-4,5-dicarbonitrile (CID 3847698) is 2-methyl-1H-imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 2-methyl-1H-imidazole-4,5-dicarbonitrile?
The canonical SMILES for 2-methyl-1H-imidazole-4,5-dicarbonitrile is Cc1nc(C#N)c(C#N)[nH]1.
What is the InChIKey of 2-methyl-1H-imidazole-4,5-dicarbonitrile?
The InChIKey is ZEAVNOQDMHVDLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4/c1-4-9-5(2-7)6(3-8)10-4/h1H3,(H,9,10).
What are the key properties of 2-methyl-1H-imidazole-4,5-dicarbonitrile?
2-methyl-1H-imidazole-4,5-dicarbonitrile has a molecular weight of 132.13 g/mol, XLogP of 0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 3847698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).