About 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one
4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one (PubChem CID 3847702) has the molecular formula C10H7Cl2N3O
and a molecular weight of 256.09 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one |
| PubChem CID | 3847702 |
| Molecular Formula | C10H7Cl2N3O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]cc1/C=N/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl2N3O/c11-7-1-2-9(8(12)3-7)13-4-6-5-14-15-10(6)16/h1-5H,(H2,14,15,16)/b13-4+ |
| InChIKey | BABNOOPZYYYTQC-YIXHJXPBSA-N |
| XLogP | 2.76 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one?
The IUPAC name of 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one (CID 3847702) is 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one?
The canonical SMILES for 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one is O=c1[nH][nH]cc1/C=N/c1ccc(Cl)cc1Cl.
What is the InChIKey of 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one?
The InChIKey is BABNOOPZYYYTQC-YIXHJXPBSA-N. The full InChI is InChI=1S/C10H7Cl2N3O/c11-7-1-2-9(8(12)3-7)13-4-6-5-14-15-10(6)16/h1-5H,(H2,14,15,16)/b13-4+.
What are the key properties of 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one?
4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one has a molecular weight of 256.09 g/mol, XLogP of 2.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dichlorophenyl)iminomethyl]-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 3847702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).