About ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate
ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate (PubChem CID 3847843) has the molecular formula C23H33N3O5
and a molecular weight of 431.53 g/mol. Its IUPAC name is ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate.
Molecular Properties
| Compound Name | ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate |
| PubChem CID | 3847843 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNC(=O)N1CCC(N2CC(c3ccccc3)OC2=O)CC1 |
| InChI | InChI=1S/C23H33N3O5/c1-2-30-21(27)11-7-4-8-14-24-22(28)25-15-12-19(13-16-25)26-17-20(31-23(26)29)18-9-5-3-6-10-18/h3,5-6,9-10,19-20H,2,4,7-8,11-17H2,1H3,(H,24,28) |
| InChIKey | SERFUKCAMCSCPL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate?
The IUPAC name of ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate (CID 3847843) is ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate.
What is the SMILES notation for ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate?
The canonical SMILES for ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate is CCOC(=O)CCCCCNC(=O)N1CCC(N2CC(c3ccccc3)OC2=O)CC1.
What is the InChIKey of ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate?
The InChIKey is SERFUKCAMCSCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33N3O5/c1-2-30-21(27)11-7-4-8-14-24-22(28)25-15-12-19(13-16-25)26-17-20(31-23(26)29)18-9-5-3-6-10-18/h3,5-6,9-10,19-20H,2,4,7-8,11-17H2,1H3,(H,24,28).
What are the key properties of ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate?
ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate has a molecular weight of 431.53 g/mol, XLogP of 3.48, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[[4-(2-oxo-5-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]hexanoate is sourced from PubChem (CID 3847843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).