C26H37N3O2 — CID 3847954
N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(2-aminoethyl)-1,3-oxazole-4-carboxamide (PubChem CID 3847954) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(2-aminoethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(2-aminoethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3847954 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-2-(2-aminoethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(CNC(=O)c3coc(CCN)n3)CCCC21C |
| InChI | InChI=1S/C26H37N3O2/c1-17(2)18-6-8-20-19(14-18)7-9-22-25(3,11-5-12-26(20,22)4)16-28-24(30)21-15-31-23(29-21)10-13-27/h6,8,14-15,17,22H,5,7,9-13,16,27H2,1-4H3,(H,28,30) |
| InChIKey | FUFPWEBOTJELGP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |