C16H15F3N2O5S — CID 3848312
[4-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl] N,N-dimethylsulfamate (PubChem CID 3848312) has the molecular formula C16H15F3N2O5S and a molecular weight of 404.37 g/mol. Its IUPAC name is [4-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl] N,N-dimethylsulfamate.
| Compound Name | [4-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl] N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 3848312 |
| Molecular Formula | C16H15F3N2O5S |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [4-[[4-(trifluoromethoxy)phenyl]carbamoyl]phenyl] N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)Oc1ccc(C(=O)Nc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H15F3N2O5S/c1-21(2)27(23,24)26-14-7-3-11(4-8-14)15(22)20-12-5-9-13(10-6-12)25-16(17,18)19/h3-10H,1-2H3,(H,20,22) |
| InChIKey | FYGCMXIVJKTIHF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |