C13H17NO4 — CID 3848624
7,9-dimethoxy-1-methyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole (PubChem CID 3848624) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 7,9-dimethoxy-1-methyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole.
| Compound Name | 7,9-dimethoxy-1-methyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole |
|---|---|
| PubChem CID | 3848624 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 7,9-dimethoxy-1-methyl-3,3a,4,9b-tetrahydrochromeno[4,3-c][1,2]oxazole |
| SMILES | COc1cc(OC)c2c(c1)OCC1CON(C)C21 |
| InChI | InChI=1S/C13H17NO4/c1-14-13-8(7-18-14)6-17-11-5-9(15-2)4-10(16-3)12(11)13/h4-5,8,13H,6-7H2,1-3H3 |
| InChIKey | MABHGRDPPVAZHP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |