4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid

C12H19NO5S — CID 3848802

IUPAC4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid
SMILESCCCCN(C(=O)C=CC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H19NO5S/c1-2-3-7-13(11(14)4-5-12(15)16)10-6-8-19(17,18)9-10/h4-5,10H,2-3,6-9H2,1H3,(H,15,16)
InChIKeyAVLYJLIIICFECV-UHFFFAOYSA-N
MW289.35 g/mol
LogP0.44
Rot. Bonds6

About 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid

4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 3848802) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid
PubChem CID3848802
Molecular FormulaC12H19NO5S
Molecular Weight289.35 g/mol
Exact Mass289.10
IUPAC Name4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid
SMILESCCCCN(C(=O)C=CC(=O)O)C1CCS(=O)(=O)C1
InChIInChI=1S/C12H19NO5S/c1-2-3-7-13(11(14)4-5-12(15)16)10-6-8-19(17,18)9-10/h4-5,10H,2-3,6-9H2,1H3,(H,15,16)
InChIKeyAVLYJLIIICFECV-UHFFFAOYSA-N
XLogP0.44
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.35
LogP ≤ 50.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid?
The IUPAC name of 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid (CID 3848802) is 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid?
The canonical SMILES for 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid is CCCCN(C(=O)C=CC(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid?
The InChIKey is AVLYJLIIICFECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5S/c1-2-3-7-13(11(14)4-5-12(15)16)10-6-8-19(17,18)9-10/h4-5,10H,2-3,6-9H2,1H3,(H,15,16).
What are the key properties of 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid?
4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid has a molecular weight of 289.35 g/mol, XLogP of 0.44, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[butyl-(1,1-dioxothiolan-3-yl)amino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 3848802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).